C28H45N3O3 — CID 42707484
3,3-dimethyl-N-[1-(3-methyl-4-octanoylpiperazin-1-yl)-1-oxo-3-phenylpropan-2-yl]butanamide (PubChem CID 42707484) has the molecular formula C28H45N3O3 and a molecular weight of 471.69 g/mol. Its IUPAC name is 3,3-dimethyl-N-[1-(3-methyl-4-octanoylpiperazin-1-yl)-1-oxo-3-phenylpropan-2-yl]butanamide.
| Compound Name | 3,3-dimethyl-N-[1-(3-methyl-4-octanoylpiperazin-1-yl)-1-oxo-3-phenylpropan-2-yl]butanamide |
|---|---|
| PubChem CID | 42707484 |
| Molecular Formula | C28H45N3O3 |
| Molecular Weight | 471.69 g/mol |
| Exact Mass | 471.35 |
| IUPAC Name | 3,3-dimethyl-N-[1-(3-methyl-4-octanoylpiperazin-1-yl)-1-oxo-3-phenylpropan-2-yl]butanamide |
| SMILES | CCCCCCCC(=O)N1CCN(C(=O)C(Cc2ccccc2)NC(=O)CC(C)(C)C)CC1C |
| InChI | InChI=1S/C28H45N3O3/c1-6-7-8-9-13-16-26(33)31-18-17-30(21-22(31)2)27(34)24(19-23-14-11-10-12-15-23)29-25(32)20-28(3,4)5/h10-12,14-15,22,24H,6-9,13,16-21H2,1-5H3,(H,29,32) |
| InChIKey | CWHOMMQNZKNRGX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.69 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|