C29H40N4O3 — CID 4006835
N-benzyl-4-[2-(octanoylamino)-3-phenylpropanoyl]piperazine-1-carboxamide (PubChem CID 4006835) has the molecular formula C29H40N4O3 and a molecular weight of 492.66 g/mol. Its IUPAC name is N-benzyl-4-[2-(octanoylamino)-3-phenylpropanoyl]piperazine-1-carboxamide.
| Compound Name | N-benzyl-4-[2-(octanoylamino)-3-phenylpropanoyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 4006835 |
| Molecular Formula | C29H40N4O3 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.31 |
| IUPAC Name | N-benzyl-4-[2-(octanoylamino)-3-phenylpropanoyl]piperazine-1-carboxamide |
| SMILES | CCCCCCCC(=O)NC(Cc1ccccc1)C(=O)N1CCN(C(=O)NCc2ccccc2)CC1 |
| InChI | InChI=1S/C29H40N4O3/c1-2-3-4-5-12-17-27(34)31-26(22-24-13-8-6-9-14-24)28(35)32-18-20-33(21-19-32)29(36)30-23-25-15-10-7-11-16-25/h6-11,13-16,26H,2-5,12,17-23H2,1H3,(H,30,36)(H,31,34) |
| InChIKey | DKKHEAVYWRPVGO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|