C23H42ClN3O3 — CID 42706562
3-chloro-2,2-dimethyl-N-[3-methyl-1-(3-methyl-4-octanoylpiperazin-1-yl)-1-oxobutan-2-yl]propanamide (PubChem CID 42706562) has the molecular formula C23H42ClN3O3 and a molecular weight of 444.06 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-N-[3-methyl-1-(3-methyl-4-octanoylpiperazin-1-yl)-1-oxobutan-2-yl]propanamide.
| Compound Name | 3-chloro-2,2-dimethyl-N-[3-methyl-1-(3-methyl-4-octanoylpiperazin-1-yl)-1-oxobutan-2-yl]propanamide |
|---|---|
| PubChem CID | 42706562 |
| Molecular Formula | C23H42ClN3O3 |
| Molecular Weight | 444.06 g/mol |
| Exact Mass | 443.29 |
| IUPAC Name | 3-chloro-2,2-dimethyl-N-[3-methyl-1-(3-methyl-4-octanoylpiperazin-1-yl)-1-oxobutan-2-yl]propanamide |
| SMILES | CCCCCCCC(=O)N1CCN(C(=O)C(NC(=O)C(C)(C)CCl)C(C)C)CC1C |
| InChI | InChI=1S/C23H42ClN3O3/c1-7-8-9-10-11-12-19(28)27-14-13-26(15-18(27)4)21(29)20(17(2)3)25-22(30)23(5,6)16-24/h17-18,20H,7-16H2,1-6H3,(H,25,30) |
| InChIKey | VBDNTOQAWNDDBA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.06 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|