C15H30N3O2+ — CID 7271374
[(2S)-3-methyl-1-[(3R)-3-methyl-4-pentanoylpiperazin-1-yl]-1-oxobutan-2-yl]azanium (PubChem CID 7271374) has the molecular formula C15H30N3O2+ and a molecular weight of 284.42 g/mol. Its IUPAC name is [(2S)-3-methyl-1-[(3R)-3-methyl-4-pentanoylpiperazin-1-yl]-1-oxobutan-2-yl]azanium.
| Compound Name | [(2S)-3-methyl-1-[(3R)-3-methyl-4-pentanoylpiperazin-1-yl]-1-oxobutan-2-yl]azanium |
|---|---|
| PubChem CID | 7271374 |
| Molecular Formula | C15H30N3O2+ |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | [(2S)-3-methyl-1-[(3R)-3-methyl-4-pentanoylpiperazin-1-yl]-1-oxobutan-2-yl]azanium |
| SMILES | CCCCC(=O)N1CCN(C(=O)[C@@H]([NH3+])C(C)C)C[C@H]1C |
| InChI | InChI=1S/C15H29N3O2/c1-5-6-7-13(19)18-9-8-17(10-12(18)4)15(20)14(16)11(2)3/h11-12,14H,5-10,16H2,1-4H3/p+1/t12-,14+/m1/s1 |
| InChIKey | WFLPGHCTNGDVAX-OCCSQVGLSA-O |
| XLogP | 0.50 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |