C25H48N4O3 — CID 42764522
6-amino-N-[1-[4-(2-ethylhexanoyl)-3-methylpiperazin-1-yl]-3-methyl-1-oxopentan-2-yl]hexanamide (PubChem CID 42764522) has the molecular formula C25H48N4O3 and a molecular weight of 452.68 g/mol. Its IUPAC name is 6-amino-N-[1-[4-(2-ethylhexanoyl)-3-methylpiperazin-1-yl]-3-methyl-1-oxopentan-2-yl]hexanamide.
| Compound Name | 6-amino-N-[1-[4-(2-ethylhexanoyl)-3-methylpiperazin-1-yl]-3-methyl-1-oxopentan-2-yl]hexanamide |
|---|---|
| PubChem CID | 42764522 |
| Molecular Formula | C25H48N4O3 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.37 |
| IUPAC Name | 6-amino-N-[1-[4-(2-ethylhexanoyl)-3-methylpiperazin-1-yl]-3-methyl-1-oxopentan-2-yl]hexanamide |
| SMILES | CCCCC(CC)C(=O)N1CCN(C(=O)C(NC(=O)CCCCCN)C(C)CC)CC1C |
| InChI | InChI=1S/C25H48N4O3/c1-6-9-13-21(8-3)24(31)29-17-16-28(18-20(29)5)25(32)23(19(4)7-2)27-22(30)14-11-10-12-15-26/h19-21,23H,6-18,26H2,1-5H3,(H,27,30) |
| InChIKey | JPYLPPIAMCHOFP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|