C19H36N4O3 — CID 42724923
N-butyl-2-methyl-4-[3-methyl-2-(propanoylamino)pentanoyl]piperazine-1-carboxamide (PubChem CID 42724923) has the molecular formula C19H36N4O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is N-butyl-2-methyl-4-[3-methyl-2-(propanoylamino)pentanoyl]piperazine-1-carboxamide.
| Compound Name | N-butyl-2-methyl-4-[3-methyl-2-(propanoylamino)pentanoyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42724923 |
| Molecular Formula | C19H36N4O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.28 |
| IUPAC Name | N-butyl-2-methyl-4-[3-methyl-2-(propanoylamino)pentanoyl]piperazine-1-carboxamide |
| SMILES | CCCCNC(=O)N1CCN(C(=O)C(NC(=O)CC)C(C)CC)CC1C |
| InChI | InChI=1S/C19H36N4O3/c1-6-9-10-20-19(26)23-12-11-22(13-15(23)5)18(25)17(14(4)7-2)21-16(24)8-3/h14-15,17H,6-13H2,1-5H3,(H,20,26)(H,21,24) |
| InChIKey | GFRYINVDSSLIRI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|