C6H10FN3O2 — CID 126989063
[2-(3-fluoroazetidin-1-yl)-2-oxoethyl]urea (PubChem CID 126989063) has the molecular formula C6H10FN3O2 and a molecular weight of 175.16 g/mol. Its IUPAC name is [2-(3-fluoroazetidin-1-yl)-2-oxoethyl]urea.
| Compound Name | [2-(3-fluoroazetidin-1-yl)-2-oxoethyl]urea |
|---|---|
| PubChem CID | 126989063 |
| Molecular Formula | C6H10FN3O2 |
| Molecular Weight | 175.16 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | [2-(3-fluoroazetidin-1-yl)-2-oxoethyl]urea |
| SMILES | NC(=O)NCC(=O)N1CC(F)C1 |
| InChI | InChI=1S/C6H10FN3O2/c7-4-2-10(3-4)5(11)1-9-6(8)12/h4H,1-3H2,(H3,8,9,12) |
| InChIKey | NRTGAIMWCLPCTP-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.16 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |