C18H31N5O3 — CID 96578533
[2-oxo-2-[4-[(3S)-3-(pyrrolidine-1-carbonyl)piperidin-1-yl]piperidin-1-yl]ethyl]urea (PubChem CID 96578533) has the molecular formula C18H31N5O3 and a molecular weight of 365.48 g/mol. Its IUPAC name is [2-oxo-2-[4-[(3S)-3-(pyrrolidine-1-carbonyl)piperidin-1-yl]piperidin-1-yl]ethyl]urea.
| Compound Name | [2-oxo-2-[4-[(3S)-3-(pyrrolidine-1-carbonyl)piperidin-1-yl]piperidin-1-yl]ethyl]urea |
|---|---|
| PubChem CID | 96578533 |
| Molecular Formula | C18H31N5O3 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | [2-oxo-2-[4-[(3S)-3-(pyrrolidine-1-carbonyl)piperidin-1-yl]piperidin-1-yl]ethyl]urea |
| SMILES | NC(=O)NCC(=O)N1CCC(N2CCC[C@H](C(=O)N3CCCC3)C2)CC1 |
| InChI | InChI=1S/C18H31N5O3/c19-18(26)20-12-16(24)21-10-5-15(6-11-21)23-9-3-4-14(13-23)17(25)22-7-1-2-8-22/h14-15H,1-13H2,(H3,19,20,26)/t14-/m0/s1 |
| InChIKey | XXOZVAGKTCEVBL-AWEZNQCLSA-N |
| XLogP | -0.02 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |