C11H19N3O2 — CID 131915772
[2-[(1S,5S)-3-azabicyclo[3.3.1]nonan-3-yl]-2-oxoethyl]urea (PubChem CID 131915772) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is [2-[(1S,5S)-3-azabicyclo[3.3.1]nonan-3-yl]-2-oxoethyl]urea.
| Compound Name | [2-[(1S,5S)-3-azabicyclo[3.3.1]nonan-3-yl]-2-oxoethyl]urea |
|---|---|
| PubChem CID | 131915772 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | [2-[(1S,5S)-3-azabicyclo[3.3.1]nonan-3-yl]-2-oxoethyl]urea |
| SMILES | NC(=O)NCC(=O)N1C[C@H]2CCC[C@@H](C2)C1 |
| InChI | InChI=1S/C11H19N3O2/c12-11(16)13-5-10(15)14-6-8-2-1-3-9(4-8)7-14/h8-9H,1-7H2,(H3,12,13,16)/t8-,9-/m0/s1 |
| InChIKey | VKHXFQFGCMDANF-IUCAKERBSA-N |
| XLogP | 0.30 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |