C7H11NO3 — CID 154349035
hydroxymethyl 3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 154349035) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is hydroxymethyl 3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | hydroxymethyl 3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 154349035 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | hydroxymethyl 3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | O=C(OCO)N1CC=CCC1 |
| InChI | InChI=1S/C7H11NO3/c9-6-11-7(10)8-4-2-1-3-5-8/h1-2,9H,3-6H2 |
| InChIKey | ZFGYWUXHRVHEOI-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|