C17H22FN3O3 — CID 110615202
4-(4-fluorophenyl)-N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-4-oxobutanamide (PubChem CID 110615202) has the molecular formula C17H22FN3O3 and a molecular weight of 335.38 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-4-oxobutanamide.
| Compound Name | 4-(4-fluorophenyl)-N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 110615202 |
| Molecular Formula | C17H22FN3O3 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 4-(4-fluorophenyl)-N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-4-oxobutanamide |
| SMILES | CN1CCN(C(=O)CNC(=O)CCC(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H22FN3O3/c1-20-8-10-21(11-9-20)17(24)12-19-16(23)7-6-15(22)13-2-4-14(18)5-3-13/h2-5H,6-12H2,1H3,(H,19,23) |
| InChIKey | GSTMNWBNNRNOML-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |