C12H23N3O3 — CID 163549649
2-methylpropyl N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]carbamate (PubChem CID 163549649) has the molecular formula C12H23N3O3 and a molecular weight of 257.33 g/mol. Its IUPAC name is 2-methylpropyl N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]carbamate.
| Compound Name | 2-methylpropyl N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 163549649 |
| Molecular Formula | C12H23N3O3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | 2-methylpropyl N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]carbamate |
| SMILES | CC(C)COC(=O)NCC(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C12H23N3O3/c1-10(2)9-18-12(17)13-8-11(16)15-6-4-14(3)5-7-15/h10H,4-9H2,1-3H3,(H,13,17) |
| InChIKey | FHZQRFLVRPYFRG-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |