C13H25N5O3S — CID 119730790
(1-aminocyclopropyl)-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]methanone (PubChem CID 119730790) has the molecular formula C13H25N5O3S and a molecular weight of 331.44 g/mol. Its IUPAC name is (1-aminocyclopropyl)-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (1-aminocyclopropyl)-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 119730790 |
| Molecular Formula | C13H25N5O3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | (1-aminocyclopropyl)-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]methanone |
| SMILES | CN1CCN(S(=O)(=O)N2CCN(C(=O)C3(N)CC3)CC2)CC1 |
| InChI | InChI=1S/C13H25N5O3S/c1-15-4-8-17(9-5-15)22(20,21)18-10-6-16(7-11-18)12(19)13(14)2-3-13/h2-11,14H2,1H3 |
| InChIKey | BKVAWFOTLHEPOE-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |