C15H30Cl2N4O3 — CID 120564429
4-amino-1-[4-(2-morpholin-4-ylacetyl)piperazin-1-yl]pentan-1-one;dihydrochloride (PubChem CID 120564429) has the molecular formula C15H30Cl2N4O3 and a molecular weight of 385.34 g/mol. Its IUPAC name is 4-amino-1-[4-(2-morpholin-4-ylacetyl)piperazin-1-yl]pentan-1-one;dihydrochloride.
| Compound Name | 4-amino-1-[4-(2-morpholin-4-ylacetyl)piperazin-1-yl]pentan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 120564429 |
| Molecular Formula | C15H30Cl2N4O3 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 4-amino-1-[4-(2-morpholin-4-ylacetyl)piperazin-1-yl]pentan-1-one;dihydrochloride |
| SMILES | CC(N)CCC(=O)N1CCN(C(=O)CN2CCOCC2)CC1.Cl.Cl |
| InChI | InChI=1S/C15H28N4O3.2ClH/c1-13(16)2-3-14(20)18-4-6-19(7-5-18)15(21)12-17-8-10-22-11-9-17;;/h13H,2-12,16H2,1H3;2*1H |
| InChIKey | TZBQKFDHBJJWEA-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |