C16H32N4O2 — CID 119875981
(2S)-2-amino-1-[4-[2-(diethylamino)acetyl]piperazin-1-yl]-4-methylpentan-1-one (PubChem CID 119875981) has the molecular formula C16H32N4O2 and a molecular weight of 312.46 g/mol. Its IUPAC name is (2S)-2-amino-1-[4-[2-(diethylamino)acetyl]piperazin-1-yl]-4-methylpentan-1-one.
| Compound Name | (2S)-2-amino-1-[4-[2-(diethylamino)acetyl]piperazin-1-yl]-4-methylpentan-1-one |
|---|---|
| PubChem CID | 119875981 |
| Molecular Formula | C16H32N4O2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | (2S)-2-amino-1-[4-[2-(diethylamino)acetyl]piperazin-1-yl]-4-methylpentan-1-one |
| SMILES | CCN(CC)CC(=O)N1CCN(C(=O)[C@@H](N)CC(C)C)CC1 |
| InChI | InChI=1S/C16H32N4O2/c1-5-18(6-2)12-15(21)19-7-9-20(10-8-19)16(22)14(17)11-13(3)4/h13-14H,5-12,17H2,1-4H3/t14-/m0/s1 |
| InChIKey | ASZLXKORPHZSEU-AWEZNQCLSA-N |
| XLogP | 0.37 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |