C19H36N4O3 — CID 55603367
2-[4-(6-acetamidohexanoyl)-1,4-diazepan-1-yl]-N,N-diethylacetamide (PubChem CID 55603367) has the molecular formula C19H36N4O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is 2-[4-(6-acetamidohexanoyl)-1,4-diazepan-1-yl]-N,N-diethylacetamide.
| Compound Name | 2-[4-(6-acetamidohexanoyl)-1,4-diazepan-1-yl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 55603367 |
| Molecular Formula | C19H36N4O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.28 |
| IUPAC Name | 2-[4-(6-acetamidohexanoyl)-1,4-diazepan-1-yl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN1CCCN(C(=O)CCCCCNC(C)=O)CC1 |
| InChI | InChI=1S/C19H36N4O3/c1-4-22(5-2)19(26)16-21-12-9-13-23(15-14-21)18(25)10-7-6-8-11-20-17(3)24/h4-16H2,1-3H3,(H,20,24) |
| InChIKey | ZCCVUAYXSHMTIL-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|