C14H26ClN3O2 — CID 60948570
2-[4-(5-chloropentanoyl)-1,4-diazepan-1-yl]-N,N-dimethylacetamide (PubChem CID 60948570) has the molecular formula C14H26ClN3O2 and a molecular weight of 303.83 g/mol. Its IUPAC name is 2-[4-(5-chloropentanoyl)-1,4-diazepan-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[4-(5-chloropentanoyl)-1,4-diazepan-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 60948570 |
| Molecular Formula | C14H26ClN3O2 |
| Molecular Weight | 303.83 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 2-[4-(5-chloropentanoyl)-1,4-diazepan-1-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1CCCN(C(=O)CCCCCl)CC1 |
| InChI | InChI=1S/C14H26ClN3O2/c1-16(2)14(20)12-17-8-5-9-18(11-10-17)13(19)6-3-4-7-15/h3-12H2,1-2H3 |
| InChIKey | XEQJDTHZPMGJLE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.83 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|