C19H36N4O4 — CID 55447166
tert-butyl N-[4-[4-[2-(diethylamino)-2-oxoethyl]piperazin-1-yl]-4-oxobutyl]carbamate (PubChem CID 55447166) has the molecular formula C19H36N4O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[2-(diethylamino)-2-oxoethyl]piperazin-1-yl]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-[2-(diethylamino)-2-oxoethyl]piperazin-1-yl]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 55447166 |
| Molecular Formula | C19H36N4O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | tert-butyl N-[4-[4-[2-(diethylamino)-2-oxoethyl]piperazin-1-yl]-4-oxobutyl]carbamate |
| SMILES | CCN(CC)C(=O)CN1CCN(C(=O)CCCNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H36N4O4/c1-6-22(7-2)17(25)15-21-11-13-23(14-12-21)16(24)9-8-10-20-18(26)27-19(3,4)5/h6-15H2,1-5H3,(H,20,26) |
| InChIKey | PTUSCQCYDWLNNI-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|