C15H30N4O2 — CID 119837474
N,N-diethyl-2-[4-[4-(methylamino)butanoyl]piperazin-1-yl]acetamide (PubChem CID 119837474) has the molecular formula C15H30N4O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is N,N-diethyl-2-[4-[4-(methylamino)butanoyl]piperazin-1-yl]acetamide.
| Compound Name | N,N-diethyl-2-[4-[4-(methylamino)butanoyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 119837474 |
| Molecular Formula | C15H30N4O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | N,N-diethyl-2-[4-[4-(methylamino)butanoyl]piperazin-1-yl]acetamide |
| SMILES | CCN(CC)C(=O)CN1CCN(C(=O)CCCNC)CC1 |
| InChI | InChI=1S/C15H30N4O2/c1-4-18(5-2)15(21)13-17-9-11-19(12-10-17)14(20)7-6-8-16-3/h16H,4-13H2,1-3H3 |
| InChIKey | CCCPATWBYDHATA-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|