C14H17F3N2O3S — CID 97012914
N-[4-[(3R)-3-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]-4-oxobutyl]thiophene-2-carboxamide (PubChem CID 97012914) has the molecular formula C14H17F3N2O3S and a molecular weight of 350.36 g/mol. Its IUPAC name is N-[4-[(3R)-3-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]-4-oxobutyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[(3R)-3-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]-4-oxobutyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 97012914 |
| Molecular Formula | C14H17F3N2O3S |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | N-[4-[(3R)-3-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]-4-oxobutyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCCC(=O)N1CC[C@](O)(C(F)(F)F)C1)c1cccs1 |
| InChI | InChI=1S/C14H17F3N2O3S/c15-14(16,17)13(22)5-7-19(9-13)11(20)4-1-6-18-12(21)10-3-2-8-23-10/h2-3,8,22H,1,4-7,9H2,(H,18,21)/t13-/m1/s1 |
| InChIKey | TYBRAYGFESYMJQ-CYBMUJFWSA-N |
| XLogP | 1.78 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|