C14H18N2O4S — CID 64605815
2-[1-[4-(thiophene-2-carbonylamino)butanoyl]azetidin-3-yl]acetic acid (PubChem CID 64605815) has the molecular formula C14H18N2O4S and a molecular weight of 310.37 g/mol. Its IUPAC name is 2-[1-[4-(thiophene-2-carbonylamino)butanoyl]azetidin-3-yl]acetic acid.
| Compound Name | 2-[1-[4-(thiophene-2-carbonylamino)butanoyl]azetidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 64605815 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 2-[1-[4-(thiophene-2-carbonylamino)butanoyl]azetidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CN(C(=O)CCCNC(=O)c2cccs2)C1 |
| InChI | InChI=1S/C14H18N2O4S/c17-12(16-8-10(9-16)7-13(18)19)4-1-5-15-14(20)11-3-2-6-21-11/h2-3,6,10H,1,4-5,7-9H2,(H,15,20)(H,18,19) |
| InChIKey | QTMPCWHOVUQRMI-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|