C19H30Cl2N4O2 — CID 120612951
3-(2-aminophenyl)-1-[4-(2-pyrrolidin-1-ylacetyl)piperazin-1-yl]propan-1-one;dihydrochloride (PubChem CID 120612951) has the molecular formula C19H30Cl2N4O2 and a molecular weight of 417.38 g/mol. Its IUPAC name is 3-(2-aminophenyl)-1-[4-(2-pyrrolidin-1-ylacetyl)piperazin-1-yl]propan-1-one;dihydrochloride.
| Compound Name | 3-(2-aminophenyl)-1-[4-(2-pyrrolidin-1-ylacetyl)piperazin-1-yl]propan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 120612951 |
| Molecular Formula | C19H30Cl2N4O2 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 3-(2-aminophenyl)-1-[4-(2-pyrrolidin-1-ylacetyl)piperazin-1-yl]propan-1-one;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccccc1CCC(=O)N1CCN(C(=O)CN2CCCC2)CC1 |
| InChI | InChI=1S/C19H28N4O2.2ClH/c20-17-6-2-1-5-16(17)7-8-18(24)22-11-13-23(14-12-22)19(25)15-21-9-3-4-10-21;;/h1-2,5-6H,3-4,7-15,20H2;2*1H |
| InChIKey | LOJXUMQANUVSRW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|