C20H21F2N3O2 — CID 108949367
3-(4-benzylpiperazin-1-yl)-N-(2,4-difluorophenyl)-3-oxopropanamide (PubChem CID 108949367) has the molecular formula C20H21F2N3O2 and a molecular weight of 373.40 g/mol. Its IUPAC name is 3-(4-benzylpiperazin-1-yl)-N-(2,4-difluorophenyl)-3-oxopropanamide.
| Compound Name | 3-(4-benzylpiperazin-1-yl)-N-(2,4-difluorophenyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 108949367 |
| Molecular Formula | C20H21F2N3O2 |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 3-(4-benzylpiperazin-1-yl)-N-(2,4-difluorophenyl)-3-oxopropanamide |
| SMILES | O=C(CC(=O)N1CCN(Cc2ccccc2)CC1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C20H21F2N3O2/c21-16-6-7-18(17(22)12-16)23-19(26)13-20(27)25-10-8-24(9-11-25)14-15-4-2-1-3-5-15/h1-7,12H,8-11,13-14H2,(H,23,26) |
| InChIKey | NHLJZVTUBYIOTF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|