C14H17ClN4S2 — CID 4653012
1-(4-chlorophenyl)-3-(cyclohex-2-en-1-ylcarbamothioylamino)thiourea (PubChem CID 4653012) has the molecular formula C14H17ClN4S2 and a molecular weight of 340.91 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(cyclohex-2-en-1-ylcarbamothioylamino)thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-(cyclohex-2-en-1-ylcarbamothioylamino)thiourea |
|---|---|
| PubChem CID | 4653012 |
| Molecular Formula | C14H17ClN4S2 |
| Molecular Weight | 340.91 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(cyclohex-2-en-1-ylcarbamothioylamino)thiourea |
| SMILES | S=C(NNC(=S)NC1C=CCCC1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H17ClN4S2/c15-10-6-8-12(9-7-10)17-14(21)19-18-13(20)16-11-4-2-1-3-5-11/h2,4,6-9,11H,1,3,5H2,(H2,16,18,20)(H2,17,19,21) |
| InChIKey | VJNNISJWNAOPPM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.91 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|