C15H18ClNS — CID 86658456
N-(4-chlorophenyl)-3-cyclohex-2-en-1-ylpropanethioamide (PubChem CID 86658456) has the molecular formula C15H18ClNS and a molecular weight of 279.84 g/mol. Its IUPAC name is N-(4-chlorophenyl)-3-cyclohex-2-en-1-ylpropanethioamide.
| Compound Name | N-(4-chlorophenyl)-3-cyclohex-2-en-1-ylpropanethioamide |
|---|---|
| PubChem CID | 86658456 |
| Molecular Formula | C15H18ClNS |
| Molecular Weight | 279.84 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | N-(4-chlorophenyl)-3-cyclohex-2-en-1-ylpropanethioamide |
| SMILES | S=C(CCC1C=CCCC1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H18ClNS/c16-13-7-9-14(10-8-13)17-15(18)11-6-12-4-2-1-3-5-12/h2,4,7-10,12H,1,3,5-6,11H2,(H,17,18) |
| InChIKey | PGOAMTUOJBVXBL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.84 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|