C13H14BrF2NO — CID 172646628
(3-bromo-4,5-difluorophenyl)-(3-methylpiperidin-1-yl)methanone (PubChem CID 172646628) has the molecular formula C13H14BrF2NO and a molecular weight of 318.16 g/mol. Its IUPAC name is (3-bromo-4,5-difluorophenyl)-(3-methylpiperidin-1-yl)methanone.
| Compound Name | (3-bromo-4,5-difluorophenyl)-(3-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 172646628 |
| Molecular Formula | C13H14BrF2NO |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | (3-bromo-4,5-difluorophenyl)-(3-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCCN(C(=O)c2cc(F)c(F)c(Br)c2)C1 |
| InChI | InChI=1S/C13H14BrF2NO/c1-8-3-2-4-17(7-8)13(18)9-5-10(14)12(16)11(15)6-9/h5-6,8H,2-4,7H2,1H3 |
| InChIKey | FPGQYFJZYFINNK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|