C27H42BN5O4 — CID 155772483
6-[2-(methoxymethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,2,4-triazin-3-amine (PubChem CID 155772483) has the molecular formula C27H42BN5O4 and a molecular weight of 511.48 g/mol. Its IUPAC name is 6-[2-(methoxymethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,2,4-triazin-3-amine.
| Compound Name | 6-[2-(methoxymethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 155772483 |
| Molecular Formula | C27H42BN5O4 |
| Molecular Weight | 511.48 g/mol |
| Exact Mass | 511.33 |
| IUPAC Name | 6-[2-(methoxymethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,2,4-triazin-3-amine |
| SMILES | COCOc1cc(B2OC(C)(C)C(C)(C)O2)ccc1-c1cnc(N(C)C2CC(C)(C)NC(C)(C)C2)nn1 |
| InChI | InChI=1S/C27H42BN5O4/c1-24(2)14-19(15-25(3,4)32-24)33(9)23-29-16-21(30-31-23)20-12-11-18(13-22(20)35-17-34-10)28-36-26(5,6)27(7,8)37-28/h11-13,16,19,32H,14-15,17H2,1-10H3 |
| InChIKey | YQENHXSGCGUMRK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 90.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|