C26H40N6O — CID 153348732
ethane;5-[N-methyl-C-[(Z)-prop-1-enyl]carbonimidoyl]-2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol (PubChem CID 153348732) has the molecular formula C26H40N6O and a molecular weight of 452.65 g/mol. Its IUPAC name is ethane;5-[N-methyl-C-[(Z)-prop-1-enyl]carbonimidoyl]-2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol.
| Compound Name | ethane;5-[N-methyl-C-[(Z)-prop-1-enyl]carbonimidoyl]-2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol |
|---|---|
| PubChem CID | 153348732 |
| Molecular Formula | C26H40N6O |
| Molecular Weight | 452.65 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | ethane;5-[N-methyl-C-[(Z)-prop-1-enyl]carbonimidoyl]-2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol |
| SMILES | C/C=C\C(=N/C)c1ccc(-c2cnc(N(C)C3CC(C)(C)NC(C)(C)C3)nn2)c(O)c1.CC |
| InChI | InChI=1S/C24H34N6O.C2H6/c1-8-9-19(25-6)16-10-11-18(21(31)12-16)20-15-26-22(28-27-20)30(7)17-13-23(2,3)29-24(4,5)14-17;1-2/h8-12,15,17,29,31H,13-14H2,1-7H3;1-2H3/b9-8-,25-19+; |
| InChIKey | YAMOZSJLNQETAB-JEZUJPMJSA-N |
| XLogP | 5.01 |
| TPSA | 86.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.65 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|