C23H30N8O2 — CID 139536902
5-(6-methoxy-1,2,4-triazin-3-yl)-2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol (PubChem CID 139536902) has the molecular formula C23H30N8O2 and a molecular weight of 450.55 g/mol. Its IUPAC name is 5-(6-methoxy-1,2,4-triazin-3-yl)-2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol.
| Compound Name | 5-(6-methoxy-1,2,4-triazin-3-yl)-2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol |
|---|---|
| PubChem CID | 139536902 |
| Molecular Formula | C23H30N8O2 |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 5-(6-methoxy-1,2,4-triazin-3-yl)-2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol |
| SMILES | COc1cnc(-c2ccc(-c3cnc(N(C)C4CC(C)(C)NC(C)(C)C4)nn3)c(O)c2)nn1 |
| InChI | InChI=1S/C23H30N8O2/c1-22(2)10-15(11-23(3,4)30-22)31(5)21-25-12-17(26-29-21)16-8-7-14(9-18(16)32)20-24-13-19(33-6)27-28-20/h7-9,12-13,15,30,32H,10-11H2,1-6H3 |
| InChIKey | ZRMSWDDIYSRGLZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 122.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |