C25H35N9O — CID 153348816
5-[6-amino-5-[amino(methyl)amino]-2-pyridinyl]-2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol (PubChem CID 153348816) has the molecular formula C25H35N9O and a molecular weight of 477.62 g/mol. Its IUPAC name is 5-[6-amino-5-[amino(methyl)amino]-2-pyridinyl]-2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol.
| Compound Name | 5-[6-amino-5-[amino(methyl)amino]-2-pyridinyl]-2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol |
|---|---|
| PubChem CID | 153348816 |
| Molecular Formula | C25H35N9O |
| Molecular Weight | 477.62 g/mol |
| Exact Mass | 477.30 |
| IUPAC Name | 5-[6-amino-5-[amino(methyl)amino]-2-pyridinyl]-2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol |
| SMILES | CN(N)c1ccc(-c2ccc(-c3cnc(N(C)C4CC(C)(C)NC(C)(C)C4)nn3)c(O)c2)nc1N |
| InChI | InChI=1S/C25H35N9O/c1-24(2)12-16(13-25(3,4)32-24)33(5)23-28-14-19(30-31-23)17-8-7-15(11-21(17)35)18-9-10-20(34(6)27)22(26)29-18/h7-11,14,16,32,35H,12-13,27H2,1-6H3,(H2,26,29) |
| InChIKey | UJIQNKSRAVNIHN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 142.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.62 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|