C24H31N7O2 — CID 139536426
1-[1-[3-hydroxy-4-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenyl]pyrazol-4-yl]ethanone (PubChem CID 139536426) has the molecular formula C24H31N7O2 and a molecular weight of 449.56 g/mol. Its IUPAC name is 1-[1-[3-hydroxy-4-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenyl]pyrazol-4-yl]ethanone.
| Compound Name | 1-[1-[3-hydroxy-4-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenyl]pyrazol-4-yl]ethanone |
|---|---|
| PubChem CID | 139536426 |
| Molecular Formula | C24H31N7O2 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | 1-[1-[3-hydroxy-4-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenyl]pyrazol-4-yl]ethanone |
| SMILES | CC(=O)c1cnn(-c2ccc(-c3cnc(N(C)C4CC(C)(C)NC(C)(C)C4)nn3)c(O)c2)c1 |
| InChI | InChI=1S/C24H31N7O2/c1-15(32)16-12-26-31(14-16)17-7-8-19(21(33)9-17)20-13-25-22(28-27-20)30(6)18-10-23(2,3)29-24(4,5)11-18/h7-9,12-14,18,29,33H,10-11H2,1-6H3 |
| InChIKey | IOGRSYJMACDTCZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 109.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |