C23H30ClN7O2 — CID 139536490
3-[3-hydroxy-4-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenyl]-1H-pyridazin-6-one;hydrochloride (PubChem CID 139536490) has the molecular formula C23H30ClN7O2 and a molecular weight of 471.99 g/mol. Its IUPAC name is 3-[3-hydroxy-4-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenyl]-1H-pyridazin-6-one;hydrochloride.
| Compound Name | 3-[3-hydroxy-4-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenyl]-1H-pyridazin-6-one;hydrochloride |
|---|---|
| PubChem CID | 139536490 |
| Molecular Formula | C23H30ClN7O2 |
| Molecular Weight | 471.99 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | 3-[3-hydroxy-4-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenyl]-1H-pyridazin-6-one;hydrochloride |
| SMILES | CN(c1ncc(-c2ccc(-c3ccc(=O)[nH]n3)cc2O)nn1)C1CC(C)(C)NC(C)(C)C1.Cl |
| InChI | InChI=1S/C23H29N7O2.ClH/c1-22(2)11-15(12-23(3,4)29-22)30(5)21-24-13-18(26-28-21)16-7-6-14(10-19(16)31)17-8-9-20(32)27-25-17;/h6-10,13,15,29,31H,11-12H2,1-5H3,(H,27,32);1H |
| InChIKey | VZZGQBJQJHABIL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.99 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |