C26H32N8O — CID 139536748
5-(1-methylpyrazolo[4,5-b]pyridin-5-yl)-2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol (PubChem CID 139536748) has the molecular formula C26H32N8O and a molecular weight of 472.60 g/mol. Its IUPAC name is 5-(1-methylpyrazolo[4,5-b]pyridin-5-yl)-2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol.
| Compound Name | 5-(1-methylpyrazolo[4,5-b]pyridin-5-yl)-2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol |
|---|---|
| PubChem CID | 139536748 |
| Molecular Formula | C26H32N8O |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | 5-(1-methylpyrazolo[4,5-b]pyridin-5-yl)-2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol |
| SMILES | CN(c1ncc(-c2ccc(-c3ccc4c(cnn4C)n3)cc2O)nn1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C26H32N8O/c1-25(2)12-17(13-26(3,4)32-25)33(5)24-27-14-20(30-31-24)18-8-7-16(11-23(18)35)19-9-10-22-21(29-19)15-28-34(22)6/h7-11,14-15,17,32,35H,12-13H2,1-6H3 |
| InChIKey | VNYDSVJCHGEVKM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 104.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |