C23H29Cl2N7O — CID 139536924
5-(2-chloropyrimidin-4-yl)-2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol;hydrochloride (PubChem CID 139536924) has the molecular formula C23H29Cl2N7O and a molecular weight of 490.44 g/mol. Its IUPAC name is 5-(2-chloropyrimidin-4-yl)-2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol;hydrochloride.
| Compound Name | 5-(2-chloropyrimidin-4-yl)-2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol;hydrochloride |
|---|---|
| PubChem CID | 139536924 |
| Molecular Formula | C23H29Cl2N7O |
| Molecular Weight | 490.44 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | 5-(2-chloropyrimidin-4-yl)-2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol;hydrochloride |
| SMILES | CN(c1ncc(-c2ccc(-c3ccnc(Cl)n3)cc2O)nn1)C1CC(C)(C)NC(C)(C)C1.Cl |
| InChI | InChI=1S/C23H28ClN7O.ClH/c1-22(2)11-15(12-23(3,4)30-22)31(5)21-26-13-18(28-29-21)16-7-6-14(10-19(16)32)17-8-9-25-20(24)27-17;/h6-10,13,15,30,32H,11-12H2,1-5H3;1H |
| InChIKey | KVXQVLZKGFPHKU-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 99.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |