C22H31ClN8O — CID 153348617
N-[amino-[3-hydroxy-4-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenyl]methylidene]-N'-methylcarbamimidoyl chloride (PubChem CID 153348617) has the molecular formula C22H31ClN8O and a molecular weight of 459.00 g/mol. Its IUPAC name is N-[amino-[3-hydroxy-4-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenyl]methylidene]-N'-methylcarbamimidoyl chloride.
| Compound Name | N-[amino-[3-hydroxy-4-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenyl]methylidene]-N'-methylcarbamimidoyl chloride |
|---|---|
| PubChem CID | 153348617 |
| Molecular Formula | C22H31ClN8O |
| Molecular Weight | 459.00 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | N-[amino-[3-hydroxy-4-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenyl]methylidene]-N'-methylcarbamimidoyl chloride |
| SMILES | C/N=C(\Cl)N=C(N)c1ccc(-c2cnc(N(C)C3CC(C)(C)NC(C)(C)C3)nn2)c(O)c1 |
| InChI | InChI=1S/C22H31ClN8O/c1-21(2)10-14(11-22(3,4)30-21)31(6)20-26-12-16(28-29-20)15-8-7-13(9-17(15)32)18(24)27-19(23)25-5/h7-9,12,14,30,32H,10-11H2,1-6H3,(H2,24,25,27) |
| InChIKey | SJJWQJDPANUMQW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 124.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.00 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|