C20H32BN3O5S — CID 99867793
(2S)-2,3-dihydroxy-1-[(2R)-2-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfanylethyl]piperidin-1-yl]propan-1-one (PubChem CID 99867793) has the molecular formula C20H32BN3O5S and a molecular weight of 437.37 g/mol. Its IUPAC name is (2S)-2,3-dihydroxy-1-[(2R)-2-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfanylethyl]piperidin-1-yl]propan-1-one.
| Compound Name | (2S)-2,3-dihydroxy-1-[(2R)-2-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfanylethyl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 99867793 |
| Molecular Formula | C20H32BN3O5S |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | (2S)-2,3-dihydroxy-1-[(2R)-2-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfanylethyl]piperidin-1-yl]propan-1-one |
| SMILES | CC1(C)OB(c2cnc(SCC[C@H]3CCCCN3C(=O)[C@@H](O)CO)nc2)OC1(C)C |
| InChI | InChI=1S/C20H32BN3O5S/c1-19(2)20(3,4)29-21(28-19)14-11-22-18(23-12-14)30-10-8-15-7-5-6-9-24(15)17(27)16(26)13-25/h11-12,15-16,25-26H,5-10,13H2,1-4H3/t15-,16+/m1/s1 |
| InChIKey | LGIAVBOXKMVEHP-CVEARBPZSA-N |
| XLogP | 0.99 |
| TPSA | 105.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|