C19H31BN4O5 — CID 99935112
(2S)-2,3-dihydroxy-N-[[(2R)-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperidin-2-yl]methyl]propanamide (PubChem CID 99935112) has the molecular formula C19H31BN4O5 and a molecular weight of 406.29 g/mol. Its IUPAC name is (2S)-2,3-dihydroxy-N-[[(2R)-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperidin-2-yl]methyl]propanamide.
| Compound Name | (2S)-2,3-dihydroxy-N-[[(2R)-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperidin-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 99935112 |
| Molecular Formula | C19H31BN4O5 |
| Molecular Weight | 406.29 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | (2S)-2,3-dihydroxy-N-[[(2R)-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperidin-2-yl]methyl]propanamide |
| SMILES | CC1(C)OB(c2cnc(N3CCCC[C@@H]3CNC(=O)[C@@H](O)CO)nc2)OC1(C)C |
| InChI | InChI=1S/C19H31BN4O5/c1-18(2)19(3,4)29-20(28-18)13-9-22-17(23-10-13)24-8-6-5-7-14(24)11-21-16(27)15(26)12-25/h9-10,14-15,25-26H,5-8,11-12H2,1-4H3,(H,21,27)/t14-,15+/m1/s1 |
| InChIKey | CMUSGBCQKZMQKZ-CABCVRRESA-N |
| XLogP | -0.40 |
| TPSA | 117.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.29 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|