C18H28BClN4O3 — CID 99867461
2-chloro-N-[[(2S)-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperidin-2-yl]methyl]acetamide (PubChem CID 99867461) has the molecular formula C18H28BClN4O3 and a molecular weight of 394.71 g/mol. Its IUPAC name is 2-chloro-N-[[(2S)-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperidin-2-yl]methyl]acetamide.
| Compound Name | 2-chloro-N-[[(2S)-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperidin-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 99867461 |
| Molecular Formula | C18H28BClN4O3 |
| Molecular Weight | 394.71 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 2-chloro-N-[[(2S)-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperidin-2-yl]methyl]acetamide |
| SMILES | CC1(C)OB(c2cnc(N3CCCC[C@H]3CNC(=O)CCl)nc2)OC1(C)C |
| InChI | InChI=1S/C18H28BClN4O3/c1-17(2)18(3,4)27-19(26-17)13-10-22-16(23-11-13)24-8-6-5-7-14(24)12-21-15(25)9-20/h10-11,14H,5-9,12H2,1-4H3,(H,21,25)/t14-/m0/s1 |
| InChIKey | LDCIHVNFAZKASQ-AWEZNQCLSA-N |
| XLogP | 1.49 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.71 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|