C16H25F3N2O3 — CID 162586956
tert-butyl N-[4-methyl-4-[[(3,3,3-trifluoro-2-oxopropylidene)amino]methyl]cyclohexyl]carbamate (PubChem CID 162586956) has the molecular formula C16H25F3N2O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is tert-butyl N-[4-methyl-4-[[(3,3,3-trifluoro-2-oxopropylidene)amino]methyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-methyl-4-[[(3,3,3-trifluoro-2-oxopropylidene)amino]methyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 162586956 |
| Molecular Formula | C16H25F3N2O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | tert-butyl N-[4-methyl-4-[[(3,3,3-trifluoro-2-oxopropylidene)amino]methyl]cyclohexyl]carbamate |
| SMILES | CC1(C/N=C/C(=O)C(F)(F)F)CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H25F3N2O3/c1-14(2,3)24-13(23)21-11-5-7-15(4,8-6-11)10-20-9-12(22)16(17,18)19/h9,11H,5-8,10H2,1-4H3,(H,21,23)/b20-9+ |
| InChIKey | QFNDXMPFUJSBKK-AWQFTUOYSA-N |
| XLogP | 3.66 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|