C16H30N2O2 — CID 159337962
N-[3-(3,3-dimethylbutanoylamino)cyclobutyl]-3,3-dimethylbutanamide (PubChem CID 159337962) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is N-[3-(3,3-dimethylbutanoylamino)cyclobutyl]-3,3-dimethylbutanamide.
| Compound Name | N-[3-(3,3-dimethylbutanoylamino)cyclobutyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 159337962 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | N-[3-(3,3-dimethylbutanoylamino)cyclobutyl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)NC1CC(NC(=O)CC(C)(C)C)C1 |
| InChI | InChI=1S/C16H30N2O2/c1-15(2,3)9-13(19)17-11-7-12(8-11)18-14(20)10-16(4,5)6/h11-12H,7-10H2,1-6H3,(H,17,19)(H,18,20) |
| InChIKey | LFTZKEDJPDRHEM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |