C11H19NO2 — CID 176762376
N-(3-formylcyclobutyl)-3,3-dimethylbutanamide (PubChem CID 176762376) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is N-(3-formylcyclobutyl)-3,3-dimethylbutanamide.
| Compound Name | N-(3-formylcyclobutyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 176762376 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | N-(3-formylcyclobutyl)-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)NC1CC(C=O)C1 |
| InChI | InChI=1S/C11H19NO2/c1-11(2,3)6-10(14)12-9-4-8(5-9)7-13/h7-9H,4-6H2,1-3H3,(H,12,14) |
| InChIKey | YHNMIXGBYDCIKT-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|