C14H25NO3 — CID 112729599
N-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-dimethylbutanamide (PubChem CID 112729599) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is N-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-dimethylbutanamide.
| Compound Name | N-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 112729599 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | N-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)NC1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C14H25NO3/c1-13(2,3)10-12(16)15-11-4-6-14(7-5-11)17-8-9-18-14/h11H,4-10H2,1-3H3,(H,15,16) |
| InChIKey | SUAVIVVWYPRCIW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |