C15H25NO3 — CID 102852259
N-cyclopentyl-2-(1,4-dioxaspiro[4.5]decan-8-yl)acetamide (PubChem CID 102852259) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is N-cyclopentyl-2-(1,4-dioxaspiro[4.5]decan-8-yl)acetamide.
| Compound Name | N-cyclopentyl-2-(1,4-dioxaspiro[4.5]decan-8-yl)acetamide |
|---|---|
| PubChem CID | 102852259 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | N-cyclopentyl-2-(1,4-dioxaspiro[4.5]decan-8-yl)acetamide |
| SMILES | O=C(CC1CCC2(CC1)OCCO2)NC1CCCC1 |
| InChI | InChI=1S/C15H25NO3/c17-14(16-13-3-1-2-4-13)11-12-5-7-15(8-6-12)18-9-10-19-15/h12-13H,1-11H2,(H,16,17) |
| InChIKey | DBPSLRRNXVFLSP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |