C12H19F2NO3 — CID 164651542
N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,2-difluorobutanamide (PubChem CID 164651542) has the molecular formula C12H19F2NO3 and a molecular weight of 263.28 g/mol. Its IUPAC name is N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,2-difluorobutanamide.
| Compound Name | N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,2-difluorobutanamide |
|---|---|
| PubChem CID | 164651542 |
| Molecular Formula | C12H19F2NO3 |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,2-difluorobutanamide |
| SMILES | CCC(F)(F)C(=O)NC1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C12H19F2NO3/c1-2-12(13,14)10(16)15-9-3-5-11(6-4-9)17-7-8-18-11/h9H,2-8H2,1H3,(H,15,16) |
| InChIKey | KJQFRFMBGZZJEZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |