C12H20N2O3 — CID 130752274
1-(1,4-dioxaspiro[4.5]decan-8-yl)-3-prop-2-enylurea (PubChem CID 130752274) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3-prop-2-enylurea.
| Compound Name | 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3-prop-2-enylurea |
|---|---|
| PubChem CID | 130752274 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)NC1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C12H20N2O3/c1-2-7-13-11(15)14-10-3-5-12(6-4-10)16-8-9-17-12/h2,10H,1,3-9H2,(H2,13,14,15) |
| InChIKey | CKBJZOAFQIEKGZ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|