C14H23N5O3S — CID 95148105
1-methylsulfonyl-N-[(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]piperidine-4-carboxamide (PubChem CID 95148105) has the molecular formula C14H23N5O3S and a molecular weight of 341.44 g/mol. Its IUPAC name is 1-methylsulfonyl-N-[(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]piperidine-4-carboxamide.
| Compound Name | 1-methylsulfonyl-N-[(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 95148105 |
| Molecular Formula | C14H23N5O3S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 1-methylsulfonyl-N-[(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]piperidine-4-carboxamide |
| SMILES | Cc1nnc2n1C[C@@H](NC(=O)C1CCN(S(C)(=O)=O)CC1)CC2 |
| InChI | InChI=1S/C14H23N5O3S/c1-10-16-17-13-4-3-12(9-19(10)13)15-14(20)11-5-7-18(8-6-11)23(2,21)22/h11-12H,3-9H2,1-2H3,(H,15,20)/t12-/m0/s1 |
| InChIKey | OEJNTKKHMJTFJQ-LBPRGKRZSA-N |
| XLogP | -0.31 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |