C19H27N7O2 — CID 154797862
1-(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-3-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]urea (PubChem CID 154797862) has the molecular formula C19H27N7O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 1-(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-3-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]urea.
| Compound Name | 1-(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-3-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]urea |
|---|---|
| PubChem CID | 154797862 |
| Molecular Formula | C19H27N7O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 1-(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-3-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]urea |
| SMILES | Cc1nnc2n1CC(NC(=O)NCc1ccc(NC(=O)NC(C)C)cc1)CC2 |
| InChI | InChI=1S/C19H27N7O2/c1-12(2)21-19(28)22-15-6-4-14(5-7-15)10-20-18(27)23-16-8-9-17-25-24-13(3)26(17)11-16/h4-7,12,16H,8-11H2,1-3H3,(H2,20,23,27)(H2,21,22,28) |
| InChIKey | CUJWZLTXXVLBCY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 112.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |