C21H34IN5O — CID 109444190
1-[4-[[[C-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N-methylcarbonimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide (PubChem CID 109444190) has the molecular formula C21H34IN5O and a molecular weight of 499.44 g/mol. Its IUPAC name is 1-[4-[[[C-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N-methylcarbonimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide.
| Compound Name | 1-[4-[[[C-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N-methylcarbonimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide |
|---|---|
| PubChem CID | 109444190 |
| Molecular Formula | C21H34IN5O |
| Molecular Weight | 499.44 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | 1-[4-[[[C-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N-methylcarbonimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(NC(=O)NC(C)C)cc1)N1CC2CCCCC2C1.I |
| InChI | InChI=1S/C21H33N5O.HI/c1-15(2)24-21(27)25-19-10-8-16(9-11-19)12-23-20(22-3)26-13-17-6-4-5-7-18(17)14-26;/h8-11,15,17-18H,4-7,12-14H2,1-3H3,(H,22,23)(H2,24,25,27);1H |
| InChIKey | MYZCYHURLSSHHE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|