C18H26N4O — CID 109442531
4-[[[C-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N-methylcarbonimidoyl]amino]methyl]benzamide (PubChem CID 109442531) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is 4-[[[C-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N-methylcarbonimidoyl]amino]methyl]benzamide.
| Compound Name | 4-[[[C-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N-methylcarbonimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 109442531 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 4-[[[C-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N-methylcarbonimidoyl]amino]methyl]benzamide |
| SMILES | C/N=C(\NCc1ccc(C(N)=O)cc1)N1CC2CCCCC2C1 |
| InChI | InChI=1S/C18H26N4O/c1-20-18(22-11-15-4-2-3-5-16(15)12-22)21-10-13-6-8-14(9-7-13)17(19)23/h6-9,15-16H,2-5,10-12H2,1H3,(H2,19,23)(H,20,21) |
| InChIKey | XQFDJLSMVOOVIT-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|