C17H23N3O3S — CID 119762276
7-amino-N-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]heptanamide (PubChem CID 119762276) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is 7-amino-N-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]heptanamide.
| Compound Name | 7-amino-N-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]heptanamide |
|---|---|
| PubChem CID | 119762276 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 7-amino-N-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]heptanamide |
| SMILES | NCCCCCCC(=O)Nc1ccc(CN2C(=O)CSC2=O)cc1 |
| InChI | InChI=1S/C17H23N3O3S/c18-10-4-2-1-3-5-15(21)19-14-8-6-13(7-9-14)11-20-16(22)12-24-17(20)23/h6-9H,1-5,10-12,18H2,(H,19,21) |
| InChIKey | KUNMSQNIEQRIPG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|